Home
Products
8-Acetyl-7-hydroxycoumarin
| Product Name | 8-Acetyl-7-hydroxycoumarin |
| Price: | Inquiry |
| Catalog No.: | CN06031 |
| CAS No.: | 6748-68-1 |
| Molecular Formula: | C11H8O4 |
| Molecular Weight: | 204.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Murraya paniculata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c(C(=O)C)c(cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.388g/cm3 |
| Boiling Point | 427.3ºC at 760 mmHg |
| Flash Point | 175.4ºC |
| Exact Mass | 204.04200 |
| PSA | 67.51000 |
| LogP | 1.70120 |
| Storage condition | 2-8°C |