Home
Products
Isorhamnetin 7-O-glucoside
| Product Name | Isorhamnetin 7-O-glucoside |
| Price: | $526 / 5mg |
| Catalog No.: | CN04456 |
| CAS No.: | 6743-96-0 |
| Molecular Formula: | C22H22O12 |
| Molecular Weight: | 478.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Brassica juncea L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(c(c3=O)O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Brassicin, a natural Flavonoid, possesses radical scavenging activity[1]. |
| Boiling Point | 822.1±65.0 °C(Predicted) |
| Exact Mass | 478.11100 |
| PSA | 199.51000 |