Home
Products
Isorhamnetin 3-O-galactoside
| Product Name | Isorhamnetin 3-O-galactoside |
| Price: | $321 / 10mg |
| Catalog No.: | CN04527 |
| CAS No.: | 6743-92-6 |
| Molecular Formula: | C22H22O12 |
| Molecular Weight: | 478.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Typha angustifolia L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)OC)O)[C@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorhamnetin 3-O-galactoside (Cacticin), a flavonoid glycoside isolated from Artemisia capillaris Thunberg, which ameliorates CCl4-induced hepatic damage by enhancing the anti-oxidative defense system and reducing the inflammatory signaling pathways. Isorhamnetin 3-O-galactoside (Cacticin) has antithrombotic and anti-inflammatory activities[1][2][3]. |
| Density | 1.75±0.1 g/cm3 |
| Boiling Point | 834.4±65.0 °C at 760 mmHg |
| Flash Point | 291.3±27.8 °C |
| Exact Mass | 478.111115 |
| PSA | 199.51000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |