Home
Products
Dihydrocatalpol
| Product Name | Dihydrocatalpol |
| Price: | $146 / 10mg |
| Catalog No.: | CN03023 |
| CAS No.: | 6736-86-3 |
| Molecular Formula: | C15H24O10 |
| Molecular Weight: | 364.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OCC[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrocatalpol can be isolated from Rehmannia glutinosa. Dihydrocatalpol can be used for research on Asthma, chronic obstructive pneumonia, allergic rhinitis[1]. |
| Storage condition | -20°C |