Home
Products
Kaurenoic acid
| Product Name | Kaurenoic acid |
| Price: | $176 / 20mg |
| Catalog No.: | CN08710 |
| CAS No.: | 6730-83-2 |
| Molecular Formula: | C20H30O2 |
| Molecular Weight: | 302.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Croton antisyphiliticus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1C[C@@]23C[C@H]1CC[C@H]3[C@]1([C@H](CC2)[C@@](C)(CCC1)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaurenoic acid is a diterpene from Sphagneticola trilobata, inhibits Inflammatory Pain by the inhibition of cytokine production and activation of the NO–cyclic GMP–PKG–ATP-sensitive potassium channel signaling pathway[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 426.6±34.0 °C at 760 mmHg |
| Flash Point | 202.8±20.3 °C |
| Exact Mass | 302.224579 |
| PSA | 37.30000 |
| LogP | 6.37 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Storage condition | ?20°C |