Home
Products
Gliotoxin
| Product Name | Gliotoxin |
| Price: | Inquiry |
| Catalog No.: | CN06544 |
| CAS No.: | 67-99-2 |
| Molecular Formula: | C13H14N2O4S2 |
| Molecular Weight: | 326.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From Gliocladium fimbriatum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC12SSC3(N(C1=O)C1[C@@H](O)C=CC=C1C3)C(=O)N2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gliotoxin is a secondary metabolite, the most abundant mycotoxin secreted by A. fumigatus, inhibits the phagocytosis of macrophages and the immune functions of other immune cells [1]. Gliotoxin inhibits inducible NF-κB activity by preventing IκB degradation, which consequently induces host-cell apoptosis[2]. Gliotoxin activates PKA and increases intracellular cAMP concentration; modulates actin cytoskeleton rearrangement to facilitate A. fumigatus internalization into lung epithelial cells[3]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 699.7±55.0 °C at 760 mmHg |
| Flash Point | 377.0±31.5 °C |
| Exact Mass | 326.039490 |
| PSA | 131.68000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |