Home
Products
Vitamin D3
| Product Name | Vitamin D3 |
| Price: | $15 / 20mg |
| Catalog No.: | CN06678 |
| CAS No.: | 67-97-0 |
| Molecular Formula: | C27H44O |
| Molecular Weight: | 384.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | White powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCC/C/2=CC=C/1C[C@@H](O)CCC1=C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cholecalciferol(Vitamin D3) is a naturally occuring form of vitamin D; Reported that upon metabolic activation, Cholecalciferol induces cell differentiation and prevents proliferation of cancer cells. IC50 value:Target: Vitamin D acts through a receptor that is a member of the ligand-dependent transcription factor superfamily. Modulates the proliferation and differentiation of both normal and cancer cells. Has antiproliferative and antimetastatic effects on breast, colon, and prostate cancer cells. Activated vitamin D receptors in intestine and bone maintain calcium absorbance and homeostasis. |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 496.4±24.0 °C at 760 mmHg |
| Flash Point | 214.2±15.1 °C |
| Exact Mass | 384.339203 |
| PSA | 20.23000 |
| LogP | 9.72 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2~8°C |