Home
Products
Thiamine hydrochloride
| Product Name | Thiamine hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN01970 |
| CAS No.: | 67-03-8 |
| Molecular Formula: | C12H18Cl2N4OS |
| Molecular Weight: | 337.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Saccharum sinense. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCCc1sc[n+](c1C)Cc1cnc(nc1N)C.[Cl-].Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Thiamine hydrochloride is an essential micronutrient needed as a cofactor for many central metabolic enzymes. |
| Density | 1.401 g/cm3 |
| Flash Point | 100ºC |
| Exact Mass | 336.057831 |
| PSA | 104.15000 |
| Storage condition | 2-8°C |