Home
Products
Magnoflorine chloride
| Product Name | Magnoflorine chloride |
| Price: | $146 / 20mg |
| Catalog No.: | CN01373 |
| CAS No.: | 6681-18-1 |
| Molecular Formula: | C20H24NO4Cl |
| Molecular Weight: | 377.87 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The flowers of Magnolia liliiflora Desr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1O)c1c(O)c(OC)cc3c1C(C2)[N+](C)(C)CC3.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Magnoflorine chloride (Magnoflorine chloride), an aporphine alkaloid found in Acoruscalamus, reduces the formation of C. albicans biofilm[1]. Magnoflorine chloride has anti-fungal, anti-antidiabetic and anti-oxidative activity[2]. |
| Exact Mass | 377.139374 |
| PSA | 58.92000 |
| Storage condition | 2-8°C |