Home
Products
Jatrorrhizine Hydrochloride
| Product Name | Jatrorrhizine Hydrochloride |
| Price: | $46 / 20mg |
| Catalog No.: | CN02104 |
| CAS No.: | 6681-15-8 |
| Molecular Formula: | C20H20ClNO4 |
| Molecular Weight: | 373.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Phellodendron chinense Schneid. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1O)CC[n+]1c2cc2ccc(c(c2c1)OC)OC.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Jatrorrhizine chloride is a potent and orally active uptake-2 transporter inhibitor, it can be isolated from various Chinese medicinal plants[1]. Jatrorrhizine chloride exhibits a critical neuroprotective role in H2O2-induced apoptosis via inhibition of MAPK pathway in HT22 hippocampal neurons[2]. |
| Target | Uptake-2 transporter[1] |
| In Vitro | Organic cation transporters (OCTs) and the plasma membrane monoamine transporter (PMAT) are major uptake-2 transporters[1]. Jatrorrhizine chloride significantly inhibits the plasma membrane monoamine transporter (PMAT) -mediated MPP+ uptake in a concentration-dependent manner with an IC50 value of 1.05 μM[1]. Jatrorrhizine chloride demonstrates a more powerful inhibition on serotonin (5-HT) and norepinephrine (NE) uptake mediated by hOCT2 and hOCT3 than that mediated by PMAT[1]. Jatrorrhizine chloride attenuates the H2O2-induced Bcl-2/Bax ratio reduction and caspase-3 activation in these neurons[2]. |
| Exact Mass | 374.11600 |
| PSA | 51.80000 |
| LogP | 3.88380 |