Home
Products
Syringaresinol-di-O-glucoside
| Product Name | Syringaresinol-di-O-glucoside |
| Price: | $146 / 10mg |
| Catalog No.: | CN02887 |
| CAS No.: | 66791-77-3 |
| Molecular Formula: | C34H46O18 |
| Molecular Weight: | 742.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(OC)cc(cc2OC)[C@@H]2OC[C@@H]3[C@H]2CO[C@H]3c2cc(OC)c(c(c2)OC)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Syringaresinol diglucoside is a natural compound from bamboo leaves[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 935.7±65.0 °C at 760 mmHg |
| Flash Point | 519.7±34.3 °C |
| Exact Mass | 742.268433 |
| PSA | 254.14000 |
| LogP | -3.91 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |