Home
Products
5-Hydroxy-7-acetoxyflavone
| Product Name | 5-Hydroxy-7-acetoxyflavone |
| Price: | $263 / 10mg |
| Catalog No.: | CN05267 |
| CAS No.: | 6674-40-4 |
| Molecular Formula: | C17H12O5 |
| Molecular Weight: | 296.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barkS of Oroxylum indicum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1cc(O)c2c(c1)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Hydroxy-7-acetoxyflavone, an active natural flavone derivative found in various plant sources, modulates several biological activities[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 510.2±50.0 °C at 760 mmHg |
| Flash Point | 192.3±23.6 °C |
| Exact Mass | 296.068481 |
| PSA | 76.74000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |