Home
Products
3-Nitro-L-tyrosine ethyl ester hydrochloride
| Product Name | 3-Nitro-L-tyrosine ethyl ester hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN01978 |
| CAS No.: | 66737-54-0 |
| Molecular Formula: | C11H15ClN2O5 |
| Molecular Weight: | 290.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCOC(=O)[C@H](Cc1ccc(c(c1)[N+](=O)[O-])O)N.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Nitro-L-tyrosine ethyl ester hydrochloride is a tyrosine derivative[1]. |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| Exact Mass | 290.06700 |
| PSA | 118.37000 |
| LogP | 2.75880 |
| Storage condition | 2-8°C |