Home
Products
Esculentoside H
| Product Name | Esculentoside H |
| Price: | $219 / 20mg |
| Catalog No.: | CN07563 |
| CAS No.: | 66656-92-6 |
| Molecular Formula: | C48H76O21 |
| Molecular Weight: | 989.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Phytolacca acinosa Roxb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2CO[C@H]([C@@H]([C@H]2O)O)O[C@H]2[C@@H](O)C[C@]3([C@H]([C@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3C[C@](C)(CC2)C(=O)OC)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Esculentoside H (EsH) is a water-soluble saponin isolated and purified from the root extract of perennial plant Phytolacca esculenta[1]. Esculentoside H (EH) has anti-tumor activity, the mechanism is related to the capacity for TNFrelease[2].Esculentoside H (EsH) suppresses colon cancer cell migration through blockage of the JNK1/2 and NF-κB signaling-mediated matrix metalloproteinases-9 (MMP-9) expression[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1042.8±65.0 °C at 760 mmHg |
| Flash Point | 295.3±27.8 °C |
| Exact Mass | 988.487915 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |