Home
Products
7-Hydroxyflavone
| Product Name | 7-Hydroxyflavone |
| Price: | $62 / 20mg |
| Catalog No.: | CN04994 |
| CAS No.: | 6665-86-7 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The barks of Acacia farnesiana. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Hydroxyflavone is a flavonoid isolated from M. indica, with anti-inflammatory activity. 7-Hydroxyflavone protects renal cells from nicotine (NIC)-associated cytotoxicity via the ERK/Nrf2/HO-1 pathway[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 450.1±45.0 °C at 760 mmHg |
| Flash Point | 176.3±22.2 °C |
| Exact Mass | 238.062988 |
| PSA | 50.44000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |