Home
Products
6-Hydroxyflavone
| Product Name | 6-Hydroxyflavone |
| Price: | $37 / 20mg |
| Catalog No.: | CN04380 |
| CAS No.: | 6665-83-4 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Thymbra spicata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Hydroxyflavone is a naturally occurring flavone, with anti-inflammatory activity. 6-Hydroxyflavone exhibits inhibitory effect towards bovine hemoglobin (BHb) glycation. 6-Hydroxyflavone can activate AKT, ERK 1/2, and JNK signaling pathways to effectively promote osteoblastic differentiation. 6-Hydroxyflavone inhibits the LPS-induced NO production[1] [2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 450.1±45.0 °C at 760 mmHg |
| Flash Point | 176.3±22.2 °C |
| Exact Mass | 238.062988 |
| PSA | 50.44000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |