Home
Products
Galangin 3-methyl ether
| Product Name | Galangin 3-methyl ether |
| Price: | $234 / 10mg |
| Catalog No.: | CN04988 |
| CAS No.: | 6665-74-3 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Alpinia officinarum Hance |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(oc2c(c1=O)c(O)cc(c2)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Methylgalangin (Galangin 3-methyl ether) is a natural flavonoid compound from the rhizome of Alpinia officinarum (AO) with antibacterial activities, which also inhibits pancreatic lipase[1][2]. |
| Density | 1.47g/cm3 |
| Boiling Point | 526.4ºC at 760 mmHg |
| Flash Point | 201.5ºC |
| Exact Mass | 284.06800 |
| PSA | 79.90000 |
| LogP | 2.87980 |
| Storage condition | 2-8℃ |