Home
Products
4',5-Dihydroxyflavone
| Product Name | 4',5-Dihydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05269 |
| CAS No.: | 6665-67-4 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Dracaena cochinchinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1cc(=O)c2c(o1)cccc2O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4',5-Dihydroxyflavone is a soybean LOX-1 and yeast α-Glucosidase inhibitor, with an Ki of 102.6 μM for soybean LOX-1 and an IC50 of 66 μM for yeast α-glucosidase. |
| Target | Ki: 102.6 μM (LOX-1)[1]. IC50: 66 μM (α-glucosidase)[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 486.0±45.0 °C at 760 mmHg |
| Flash Point | 190.0±22.2 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8℃ |