Home
Products
Ethyl caffeate
| Product Name | Ethyl caffeate |
| Price: | Inquiry |
| Catalog No.: | CN06943 |
| CAS No.: | 66648-50-8 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Ferula assafoetida L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ethyl trans-caffeate is the trans form of Ethyl Caffeate (HY-N6966). Ethyl Caffeate is a natural phenolic compound isolated from Bidens pilosa. Ethyl caffeate suppresses NF-κB activation and its downstream inflammatory mediators, inducible nitric oxide synthase (iNOS), cyclooxygenase-2 (COX-2), and prostaglandin E2 (PGE2) in vitro or in mouse skin[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 377.0±32.0 °C at 760 mmHg |
| Flash Point | 148.4±18.6 °C |
| Exact Mass | 208.073563 |
| PSA | 66.76000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8℃ |