Home
Products
N-p-Coumaroyloctopamine
| Product Name | N-p-Coumaroyloctopamine |
| Price: | $293 / 10mg |
| Catalog No.: | CN01378 |
| CAS No.: | 66648-45-1 |
| Molecular Formula: | C17H17NO4 |
| Molecular Weight: | 299.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tuber tissue of potato. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(NCC(c1ccc(cc1)O)O)/C=C/c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-trans-p-coumaroyloctopamine is a phenylpropanoid amide isolated from eggplant (Solanum melongena L.)[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 638.9±55.0 °C at 760 mmHg |
| Flash Point | 340.2±31.5 °C |
| Exact Mass | 299.115753 |
| PSA | 89.79000 |
| LogP | 1.26 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |