Home
Products
N-Feruloyloctopamine
| Product Name | N-Feruloyloctopamine |
| Price: | $307 / 10mg |
| Catalog No.: | CN01377 |
| CAS No.: | 66648-44-0 |
| Molecular Formula: | C18H19NO5 |
| Molecular Weight: | 329.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Datura arborea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)NCC(c2ccc(cc2)O)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Feruloyloctopamine, isolated from Garlic skin, is an antioxidant constituent. N-Feruloyloctopamine significantly decreases the phosphorylation levels of Akt and p38 MAPK[1]. |
| Target | Akt p38 MAPK |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 652.5±55.0 °C at 760 mmHg |
| Flash Point | 348.4±31.5 °C |
| Exact Mass | 329.126312 |
| PSA | 99.02000 |
| LogP | 1.03 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |