Home
Products
N-trans-Feruloyltyramine
| Product Name | N-trans-Feruloyltyramine |
| Price: | $143 / 5mg |
| Catalog No.: | CN06944 |
| CAS No.: | 66648-43-9 |
| Molecular Formula: | C18H19NO4 |
| Molecular Weight: | 313.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cannabis sativa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)NCCc2ccc(cc2)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-trans-Feruloyltyramine (N-feruloyltyramine), an alkaloid from Piper nigru, is an inhibitor of COX1 and COX2, with potential antioxidant properties. N-trans-Feruloyltyramine possesses anti-inflammatory activity[1]. |
| Target | COX-1 COX-2 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 554.2±60.0 °C at 760 mmHg |
| Flash Point | 289.0±32.9 °C |
| Exact Mass | 313.131409 |
| PSA | 78.79000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | ?20°C |