Home
Products
Dihydrorotenone
| Product Name | Dihydrorotenone |
| Price: | Inquiry |
| Catalog No.: | CN04909 |
| CAS No.: | 6659-45-6 |
| Molecular Formula: | C23H24O6 |
| Molecular Weight: | 396.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Derris trifoliata Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)OC[C@@H]1[C@H]2C(=O)c2c(O1)c1C[C@@H](Oc1cc2)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrorotenone, a natural pesticide, is a potent mitochondrial inhibitor. Dihydrorotenone probably induces Parkinsonian syndrome. Dihydrorotenone induces human plasma cell apoptosis by triggering endoplasmic reticulum stress and activating p38 signaling pathway[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 553.9±50.0 °C at 760 mmHg |
| Flash Point | 241.6±30.2 °C |
| Exact Mass | 396.157288 |
| PSA | 63.22000 |
| LogP | 4.82 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |