Home
Products
Dihydroguaiaretic acid
| Product Name | Dihydroguaiaretic acid |
| Price: | Inquiry |
| Catalog No.: | CN02920 |
| CAS No.: | 66322-34-7 |
| Molecular Formula: | C20H26O4 |
| Molecular Weight: | 330.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Saururus chinensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)C[C@H]([C@H](Cc1ccc(c(c1)OC)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroguaiaretic acid, is isolated from the fruits of Schisandra chinensis with an anti-cancer activty[1]. |
| In Vitro | Dihydroguaiaretic acid shows inhibitory effect on Human ovarian cancer cells and A2780 Human endometrial cancer cells Ishikawa with IC50 values of 27.17 μM and 45.46 μM, respectively[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 488.3±40.0 °C at 760 mmHg |
| Flash Point | 249.1±27.3 °C |
| Exact Mass | 330.183105 |
| PSA | 58.92000 |
| LogP | 4.33 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |