Home
Products
Cimicifugoside
| Product Name | Cimicifugoside |
| Price: | Inquiry |
| Catalog No.: | CN07733 |
| CAS No.: | 66176-93-0 |
| Molecular Formula: | C37H54O11 |
| Molecular Weight: | 674.81 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Saposhnikovia divaricata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)O[C@@H]1C[C@]23C[C@]43CC[C@@H](C([C@@H]4CC=C2[C@]2([C@@]1(C)[C@H]1[C@H](C)C[C@@]3(O[C@H]1C2)OC([C@@]1([C@H]3O1)C)O)C)(C)C)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimicifugoside, a triterpenoid isolated from Cimicifuga simplex, is a novel specific nucleoside transport inhibitor that displays synergistic potentiation of methotrexate cytotoxicity[1]. Cimicifugoside shows immunosuppressive activity, which is preferentially directed toward B-cell function with larger doses being required for suppression of T-cell function[2]. |
| Target | Nucleoside transport[1] |
| Density | 1.38 g/cm3 |
| Exact Mass | 674.36700 |
| PSA | 156.67000 |
| LogP | 2.94870 |