Home
Products
Angeloylgomisin H
| Product Name | Angeloylgomisin H |
| Price: | $204 / 10mg |
| Catalog No.: | CN02813 |
| CAS No.: | 66056-22-2 |
| Molecular Formula: | C28H36O8 |
| Molecular Weight: | 500.58 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(/C(=O)Oc1c(OC)c(OC)cc2c1c1c(cc(c(c1OC)OC)OC)CC(C(C2)C)(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Angeloylgomisin H, as a major lignin extract of Schisandra rubriflora, has the potential to improve insulin-stimulated glucose uptake by activating PPAR-γ[1]. |
| Target | PPAR-γ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 656.3±55.0 °C at 760 mmHg |
| Flash Point | 212.3±25.0 °C |
| Exact Mass | 500.241028 |
| PSA | 92.68000 |
| LogP | 4.92 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | 2-8℃ |