Home
Products
Licoisoflavone A
| Product Name | Licoisoflavone A |
| Price: | $321 / 5mg |
| Catalog No.: | CN04819 |
| CAS No.: | 66056-19-7 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)ccc(c1O)c1coc2c(c1=O)c(O)cc(c2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoisoflavone A, an isoflavone, mainly derived from Glycyrrhiza uralensis Fisch.[1]. Licoisoflavone A inhibits lipid peroxidation with an IC50 of 7.2 μM[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 635.7±55.0 °C at 760 mmHg |
| Flash Point | 230.9±25.0 °C |
| Exact Mass | 354.110352 |
| PSA | 111.13000 |
| LogP | 5.08 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8C |