Home
Products
Punicalin
| Product Name | Punicalin |
| Price: | $146 / 10mg |
| Catalog No.: | CN04071 |
| CAS No.: | 65995-64-4 |
| Molecular Formula: | C34H22O22 |
| Molecular Weight: | 782.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1OC2COC(=O)c3cc(O)c(c(c3c3c(O)c(O)c4c5c3c(=O)oc3c(c(c(c6c(C(=O)OC2C(C1O)O)cc(O)c(c6O)O)c(c(=O)o4)c53)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Punicalin is a hydrolyzable tannin isolated from Punica granatum L. or the leaves of Terminalia catappa L.. Punicalin is a anti-hepatitis B virus (HBV) agent and has anti-inflammatory activity[1][2]. |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 1559.6±65.0 °C at 760 mmHg |
| Flash Point | 484.7±27.8 °C |
| Exact Mass | 782.060242 |
| PSA | 385.24000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20°C |