Home
Products
Punicalagin
| Product Name | Punicalagin |
| Price: | $77 / 20mg |
| Catalog No.: | CN04083 |
| CAS No.: | 65995-63-3 |
| Molecular Formula: | C48H28O30 |
| Molecular Weight: | 1084.72 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peel of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=CC1OC(=O)c2cc(O)c(c(c2c2c(C(=O)OC1C1OC(=O)c3cc(O)c(c(c3c3c(O)c(O)c4c5c3c(=O)oc3c5c(c(c5c(C(=O)OCC1O)cc(O)c(c5O)O)c(O)c3O)c(=O)o4)O)O)cc(c(c2O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Punicalagin is a polyphenol ingredient isolated from Pomegranate (Punica granatum L.) or the leaves of Terminalia catappa L.. Punicalagin is a anti-hepatitis B virus (HBV) agent and has antioxidant, anti-inflammatory, and anticancer effects[1][2][3]. |
| In Vitro | Punicalagin (100 mg/ml) induces apoptosis in HT-29, HCT116 colon cells[1]. |
| In Vivo | Punicalagin (10 mg/kg) inhibits the edema rate of 58.15% in rats[2]. |
| Density | 2.1±0.1 g/cm3 |
| Exact Mass | 1084.066528 |
| PSA | 518.76000 |
| LogP | 2.36 |
| Storage condition | 2-8°C |