Home
Products
Danshenxinkun A
| Product Name | Danshenxinkun A |
| Price: | Inquiry |
| Catalog No.: | CN08699 |
| CAS No.: | 65907-75-7 |
| Molecular Formula: | C18H16O4 |
| Molecular Weight: | 296.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC(C1=C(O)C(=O)c2c(C1=O)ccc1c2cccc1C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Danshenxinkun A is a natural compound that could be isolated from Tanshen and is used in the study for heart diseases[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 527.7±50.0 °C at 760 mmHg |
| Flash Point | 287.0±26.6 °C |
| Exact Mass | 296.104858 |
| PSA | 74.60000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |