Home
Products
Apramycin sulfate
| Product Name | Apramycin sulfate |
| Price: | Inquiry |
| Catalog No.: | CN06361 |
| CAS No.: | 65710-07-8 |
| Molecular Formula: | C21H41N5O11.H2SO4 |
| Molecular Weight: | 637.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OS(=O)(=O)O.CNC1C(OC2C(C1O)OC(C(C2)N)OC1C(N)CC(C(C1O)O)N)OC1OC(CO)C(C(C1O)O)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Apramycin sulfate is an aminoglycoside antibiotic mproduced by a strain of Streptomyces tenebrarius, used in veterinary practice. |
| Density | 1.56 |
| Boiling Point | 949.8ºC at 760 mmHg |
| Flash Point | 528.2ºC |
| Exact Mass | 637.247620 |
| PSA | 41.99000 |
| LogP | 3.82570 |
| Storage condition | 2-8°C |