Home
Products
3',4',7,8-Tetramethoxyflavone
| Product Name | 3',4',7,8-Tetramethoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04321 |
| CAS No.: | 65548-55-2 |
| Molecular Formula: | C19H18O6 |
| Molecular Weight: | 342.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus reticulata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)c1cc(=O)c2c(o1)c(OC)c(cc2)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.243g/cm3 |
| Boiling Point | 512.1ºC at 760 mmHg |
| Flash Point | 226.3ºC |
| Exact Mass | 342.11000 |
| PSA | 67.13000 |
| LogP | 3.49440 |
| Storage condition | 2-8°C |