Home
Products
Chicoric acid
| Product Name | Chicoric acid |
| Price: | $69 / 20mg |
| Catalog No.: | CN07010 |
| CAS No.: | 6537-80-0 |
| Molecular Formula: | C22H18O12 |
| Molecular Weight: | 474.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Echinacea purpurea |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@H]([C@H](C(=O)O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cichoric Acid, a natural product, is reported to be antioxidative. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 785.0±60.0 °C at 760 mmHg |
| Flash Point | 272.9±26.4 °C |
| Exact Mass | 474.079834 |
| PSA | 208.12000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | ?20°C |