Home
Products
Demethylvestitol
| Product Name | Demethylvestitol |
| Price: | Inquiry |
| Catalog No.: | CN04850 |
| CAS No.: | 65332-45-8 |
| Molecular Formula: | C15H14O4 |
| Molecular Weight: | 258.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Spatholobus suberectus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)OCC(C2)c1ccc(cc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 490.9±34.0 °C at 760 mmHg |
| Flash Point | 250.7±25.7 °C |
| Exact Mass | 258.089203 |
| PSA | 69.92000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |