Home
Products
Gossypin
| Product Name | Gossypin |
| Price: | $467 / 10mg |
| Catalog No.: | CN04608 |
| CAS No.: | 652-78-8 |
| Molecular Formula: | C21H20O13 |
| Molecular Weight: | 480.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(O)cc(c3c2oc(c2ccc(c(c2)O)O)c(c3=O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gossypin is a flavone isolated from Hibiscus vitifolius and has antioxidant, antiinflammatory, anticancer, anticataract, antidiabetic, analgesic and hepatoprotective activities. Gossypin inhibits NF-κB and NF-κB-regulated gene expression. Gossypin inhibits RANKL-induced osteoclastogenesis both in mouse primary bone marrow cells and RAW 264.7 cells in vitro[1][2]. |
| Target | IC50: NF-κB[1] |
| Density | 1.883 g/cm3 |
| Boiling Point | 886ºC at 760 mmHg |
| Flash Point | 310.8ºC |
| Exact Mass | 480.09000 |
| PSA | 230.74000 |