Home
Products
4'-Hydroxyflavanone
| Product Name | 4'-Hydroxyflavanone |
| Price: | Inquiry |
| Catalog No.: | CN04785 |
| CAS No.: | 6515-37-3 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The aerial part of Lawsonia inermis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C1CC(=O)c2c(O1)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Hydroxyflavanone is an inhibitor of SREBP maturation and lipid synthesis. 4'-Hydroxyflavanone is a synthetic analogue of flavanone, has potential for hepatic steatosis and dyslipidemia research[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 447.5±45.0 °C at 760 mmHg |
| Flash Point | 174.0±22.2 °C |
| Exact Mass | 240.078644 |
| PSA | 46.53000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |