Home
Products
7-Hydroxyflavanone
| Product Name | 7-Hydroxyflavanone |
| Price: | $28 / 20mg |
| Catalog No.: | CN04787 |
| CAS No.: | 6515-36-2 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The stems of Spatholobus suberectus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)OC(CC2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Hydroxyflavanone is an aromatase (cytochrome P450 19; CYP19) inhibitor with an IC50 of 65 μM[1]. |
| Target | IC50: 65 μM (Aromatase)[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 464.3±45.0 °C at 760 mmHg |
| Flash Point | 181.2±22.2 °C |
| Exact Mass | 240.078644 |
| PSA | 46.53000 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |