Home
Products
Schisantherin E
| Product Name | Schisantherin E |
| Price: | $277 / 10mg |
| Catalog No.: | CN02769 |
| CAS No.: | 64917-83-5 |
| Molecular Formula: | C30H34O9 |
| Molecular Weight: | 538.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schisandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(c(c1OC)OC)c1c(cc(c(c1OC)OC)O)C[C@@H]([C@]([C@H]2OC(=O)c1ccccc1)(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schisantherin E is a natural compound isolated from the active fraction of the fruits of Schisandra sphenanthera Rehd. et Wils. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 692.2±55.0 °C at 760 mmHg |
| Flash Point | 223.1±25.0 °C |
| Exact Mass | 538.220276 |
| PSA | 112.91000 |
| LogP | 5.26 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2-8℃ |