Home
Products
(-)-Carvone
| Product Name | (-)-Carvone |
| Price: | $31 / 100mg |
| Catalog No.: | CN09584 |
| CAS No.: | 6485-40-1 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Mentha spicata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C)[C@@H]1CC=C(C(=O)C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Carvone is an insect neurotoxin and a irreversible acetylcholinesterase (AChE) inhibitor. (-)-Carvone can be used as a bird repellent, inhibits larval growth, decreases pupatation rate, and increases mortality of larvae[1][2]. |
| Target | eel AChE:2.19 mM (Ki) |
| In Vitro | (-)-Carvone (3.04 mM; 30 min) inactivates eel AChE with Ki value of 2.19 mM[1]. |
| In Vivo | (-)-Carvone (5% in absolute ethanol v/v, 20 μL; application to the thoraces ventral surfaces) inhibits AChE such as horse serum cholinesterase, house fly head cholinesterases, and head and thorax cholinesterases from the Madagascar roach in vitro[1]. (-)-Carvone (0.05%-0.1% w/v; p.o.; 7 d) inhibits E. insulana larvae growth, decreases weight of larvae[2]. Animal Model: Female roaches (Gromphadorhina portentosa) (6.4 g-6.8 g)[1] Dosage: 5% in absolute ethanol v/v, 20 μL Administration: Application to the ventral surfaces of their thoraces; decapitated and crude at various time intervals (0, 2, 4, 5, 20, 24, and 26 hr) Result: Inhibited the activity of AChE in the extracts of both the head and thorax. |
| Density | 0.958 |
| Boiling Point | 227-230 ºC |
| Flash Point | 88 ºC |
| Exact Mass | 150.104462 |
| PSA | 17.07000 |
| LogP | 2.27 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |