Home
Products
Sophocarpine
| Product Name | Sophocarpine |
| Price: | Inquiry |
| Catalog No.: | CN00867 |
| CAS No.: | 6483-15-4 |
| Molecular Formula: | C15H22N2O |
| Molecular Weight: | 246.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=CC[C@H]2N1C[C@@H]1CCCN3[C@@H]1[C@@H]2CCC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sophocarpine is one of the significant alkaloid extracted from the traditional herb medicine Sophora flavescens which has many pharmacological properties such as anti-virus, anti-tumor, anti-inflammatory. Sophocarpine significantly inhibits the growth of gastric cancer (GC) cells through multiple mechanisms such as induction of autophagy, activation of cell apoptosis and down-regulation of cell survival PI3K/AKT signaling pathway. Sophocarpine has been demonstrated to have anti-tumor activity in various cancer cells, including hepatocellular carcinoma, prostate cancer and colorectal cancer[1]. |
| Target | PI3K Akt |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 425.4±45.0 °C at 760 mmHg |
| Flash Point | 194.0±21.1 °C |
| Exact Mass | 246.173218 |
| PSA | 23.55000 |
| LogP | 1.37 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |