Home
Products
Vitexin-2''-O-rhamnoside
| Product Name | Vitexin-2''-O-rhamnoside |
| Price: | $77 / 20mg |
| Catalog No.: | CN05420 |
| CAS No.: | 64820-99-1 |
| Molecular Formula: | C27H30O14 |
| Molecular Weight: | 578.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Crataegus pinnatifida Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vitexin-2-O-rhamnoside, a main flavonoid glycoside of the leaves of Cratagus pinnatifida Bge, contributes to the protection against H2O2-mediated oxidative stress damage and has potential to treat cardiovascular system diseases[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 898.8±65.0 °C at 760 mmHg |
| Flash Point | 299.5±27.8 °C |
| Exact Mass | 578.163574 |
| PSA | 239.97000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |