Home
Products
Neomangiferin
| Product Name | Neomangiferin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05834 |
| CAS No.: | 64809-67-2 |
| Molecular Formula: | C25H28O16 |
| Molecular Weight: | 584.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The herbs of Mangifera indica L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(cc2O)oc2c(c3=O)c(O)c(c(c2)O)[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neomangiferin is a natural C-glucosyl xanthone isolated from m the dried rhizome of Anemarrhena asphodeloides. Neomangiferin has significant therapeutic effects on high-fat diet-induced nonalcoholic fatty liver disease (NAFLD) in rats[1]. |
| Density | 1.839 |
| Boiling Point | 1026.377ºC at 760 mmHg |
| Flash Point | 343.913ºC |
| Exact Mass | 584.13800 |
| PSA | 280.43000 |