Home
Products
Demethylwedelolactone
| Product Name | Demethylwedelolactone |
| Price: | $176 / 20mg |
| Catalog No.: | CN06179 |
| CAS No.: | 6468-55-9 |
| Molecular Formula: | C15H8O7 |
| Molecular Weight: | 300.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Eclipta prostrata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(=O)c1c2oc2c1cc(c(c2)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethylwedelolactone is a naturally occurring coumestan isolated from Eclipta alba. Demethylwedelolactone is a potent trypsin inhibitor with an IC50 of 3.0 μM. Demethylwedelolactone suppresses cell motility and cell invasion of breast cancer cell[1][2]. |
| Target | IC50: 3.0 μM (trypsin)[1] |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 531.4±35.0 °C at 760 mmHg |
| Flash Point | 275.2±25.9 °C |
| Exact Mass | 300.027008 |
| PSA | 124.27000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8℃ |