Home
Products
Diosmetinidin chloride
| Product Name | Diosmetinidin chloride |
| Price: | Inquiry |
| Catalog No.: | CN04404 |
| CAS No.: | 64670-94-6 |
| Molecular Formula: | C16H13ClO5 |
| Molecular Weight: | 320.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1O)c1ccc2c([o+]1)cc(cc2O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 320.04500 |
| PSA | 85.89000 |
| LogP | 4.74650 |