Home
Products
Glycoursodeoxycholic acid
| Product Name | Glycoursodeoxycholic acid |
| Price: | Inquiry |
| Catalog No.: | CN02375 |
| CAS No.: | 64480-66-6 |
| Molecular Formula: | C26H43NO5 |
| Molecular Weight: | 449.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The metabolites of ursodeoxycholic acid. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]2([C@@H](C1)C[C@@H]([C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)NCC(=O)O)C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glycoursodeoxycholic acid, a acyl glycine and a bile acid-glycine conjugate, is a metabolite of ursodeoxycholic acid.In Vitro: The antioxidant compound glycoursodeoxycholic acid (GUDCA) fully abrogates UCB-induced cytochrome c oxidase inhibition and significantly prevents oxidative stress, metabolic alterations, and cell demise[1].GUDCA has shown therapeutic efficacy in neurodegenerative models and diseases. Increased cytosolic SOD1 inclusions were observed in 4 DIV NSC-34/hSOD1(G93A) cells together with decreased mitochondria viability, caspase-9 activation, and apoptosis[2]. Glycoursodeoxycholic acid shows preventive and restorative effects against unconjugated bilirubin -induced blood-brain barrier disruption and damage to human brain microvascular endothelial cells[3]. |
| Exact Mass | 449.31400 |
| PSA | 106.86000 |
| LogP | 3.98500 |
| Storage condition | -20°C Freezer |