Home
Products
Picroside III
| Product Name | Picroside III |
| Price: | $131 / 10mg |
| Catalog No.: | CN03173 |
| CAS No.: | 64461-95-6 |
| Molecular Formula: | C25H30O13 |
| Molecular Weight: | 538.50 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | White powder |
| Source: | The roots of Picrorhiza scrophulariiflora |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@]12O[C@H]2[C@H]([C@H]2[C@@H]1[C@@H](OC=C2)O[C@@H]1O[C@H](COC(=O)/C=C/c2ccc(c(c2)OC)O)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Picroside III is an iridoid glycoside isolated from Picrorhiza scrophulariiflora (PS), a traditional Chinese medicine[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 791.2±60.0 °C at 760 mmHg |
| Flash Point | 266.9±26.4 °C |
| Exact Mass | 538.168640 |
| PSA | 197.13000 |
| LogP | -2.58 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2-8C |