Home
Products
Dulcoside A
| Product Name | Dulcoside A |
| Price: | Inquiry |
| Catalog No.: | CN08599 |
| CAS No.: | 64432-06-0 |
| Molecular Formula: | C38H60O17 |
| Molecular Weight: | 788.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Stevia rebaudiana |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@]23CC[C@@H]4[C@@](C2)(CC3=C)CC[C@H]2[C@@]4(C)CCC[C@@]2(C)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dulcoside A is isolated from Stevia rebaudiana, it often advertised as a sweetener[1]. |
| Density | 1.49±0.1 g/cm3(Predicted) |
| Boiling Point | 928.4±65.0 °C(Predicted) |
| Exact Mass | 788.38300 |
| PSA | 274.75000 |
| Storage condition | 2-8°C |