Home
Products
Shanzhiside methylester
| Product Name | Shanzhiside methylester |
| Price: | $92 / 20mg |
| Catalog No.: | CN03134 |
| CAS No.: | 64421-28-9 |
| Molecular Formula: | C17H26O11 |
| Molecular Weight: | 406.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lamiophlomis rotata (Benth.) Kudo. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@](C)(O)C[C@H]3O)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shanzhiside methy lester is isolated from L. rotata. Shanzhiside methyl ester is a small molecule glucagon-like peptide-1 (GLP-1) receptor agonist and has the ability to induce anti-allodynic tolerance[1]. |
| Target | IC50: GLP-1 receptor[1] |
| In Vivo | Shanzhiside methyl ester exerts dose-dependent and long-lasting (>4 h) anti-allodynic effects in spinal nerve injury-induced neuropathic rats, with a maximal inhibition of 49% and a projected ED50 of 40.4 μg[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 651.4±55.0 °C at 760 mmHg |
| Flash Point | 233.0±25.0 °C |
| Exact Mass | 406.147522 |
| PSA | 175.37000 |
| LogP | -3.25 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |