Home
Products
2-(2-Hydroxybenzal)acetophenone
| Product Name | 2-(2-Hydroxybenzal)acetophenone |
| Price: | Inquiry |
| Catalog No.: | CN04381 |
| CAS No.: | 644-78-0 |
| Molecular Formula: | C15H12O2 |
| Molecular Weight: | 224.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(c1ccccc1)/C=C/c1ccccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-hydroxychalcone, a natural flavonoid, is a potent antioxidant, inhibiting lipid peroxidation. 2-Hydroxychalcone induces apoptosis by Bcl-2 downregulation. 2-Hydroxychalcone inhibits the activation of NF-kB[1][2][3]. |
| In Vitro | 2-Hydroxychalcone inhibits invasion of triple negative breast cancer cells[1]. 2-hydroxychalcone inhibits the adhesion of peripheral neutrophils to the endothelial cell monolayers by inhibiting the expression of ICAM-1, VCAM-1, and E-selectin in a concentration-dependent manner[2]. |
| Density | 1.191g/cm3 |
| Boiling Point | 396.566ºC at 760 mmHg |
| Flash Point | 169.35ºC |
| Exact Mass | 224.08400 |
| PSA | 37.30000 |
| LogP | 3.28830 |