Home
Products
Precocene II
| Product Name | Precocene II |
| Price: | Inquiry |
| Catalog No.: | CN03935 |
| CAS No.: | 644-06-4 |
| Molecular Formula: | C13H16O3 |
| Molecular Weight: | 220.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Centaurea solstitialis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2OC(C)(C)C=Cc2cc1OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Precocene II is the insect antijuvenile hormone[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 300.4±42.0 °C at 760 mmHg |
| Flash Point | 100.0±25.2 °C |
| Exact Mass | 220.109940 |
| PSA | 27.69000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | -20°C Freezer |